| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1,2-Diphenyl-4-Propylidene-3,5-Pyrazolidinedione |
|---|---|
| Synonyms | 1,2-Diphenyl-4-propylidene-3,5-pyrazolidinedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.33 |
| CAS Registry Number | 2810-68-6 |
| SMILES | O=C3/C(C(=O)N(c1ccccc1)N3c2ccccc2)=C\CC |
| InChI | 1S/C18H16N2O2/c1-2-9-16-17(21)19(14-10-5-3-6-11-14)20(18(16)22)15-12-7-4-8-13-15/h3-13H,2H2,1H3 |
| InChIKey | UORSDKIDYPKOBA-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.007°C at 760 mmHg (Cal.) |
| Flash point | 177.841°C (Cal.) |
| Refractive index | 1.683 (Cal.) |
| (1) | Selva A, Citterio A, Merlini L. Mass Spectrometry of Heterocyclic compounds. VIII. Electron-impact-induced fragmentation of 1,2-diphenyl-pyrazolidine-3,5-dione and some 4-substituted derivatives, Organic Mass Spectrometry 1975, 10, 606-616 |
|---|---|
| Market Analysis Reports |