| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 3-(1-Methylpyrrolidin-2-Yl)-1-Oxidopyridin-1-Ium |
|---|---|
| Synonyms | 3-(1-Methylpyrrolidin-2-Yl)-1-Oxido-Pyridin-1-Ium; 3-(1-Methyl-2-Pyrrolidinyl)-1-Oxidopyridin-1-Ium; (S)-3-(1-Methyl-2-Pyrrolidinyl)Pyridine 1-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 |
| CAS Registry Number | 2820-55-5 |
| SMILES | C1=[N+](C=CC=C1C2N(CCC2)C)[O-] |
| InChI | 1S/C10H14N2O/c1-11-6-3-5-10(11)9-4-2-7-12(13)8-9/h2,4,7-8,10H,3,5-6H2,1H3 |
| InChIKey | YHXKVHQFWVYXIC-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.899°C at 760 mmHg (Cal.) |
| Flash point | 164.204°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Bee Lan Lee, Yanhong Gao, Ai Li New, Xu Wang, Woon-Puay Koh and Choon Nam Ong. A novel C-phenyl liquid chromatographic technique for rapid and simultaneous measurements of urinary cotinine and nicotine, Anal. Methods, 2010, 2, 878. |
|---|---|
| Market Analysis Reports |