|
CAS#: 28233-35-4 Product: 1,3,5-Trihydroxy-2,4-bis(3-methyl-2-buten-1-yl)-9(10H)-Acridinone No suppilers available for the product. |
| Name | 1,3,5-Trihydroxy-2,4-bis(3-methyl-2-buten-1-yl)-9(10H)-Acridinone |
|---|---|
| Synonyms | Atalaphylline; C10645 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.45 |
| CAS Registry Number | 28233-35-4 |
| SMILES | C1=CC=C(C2=C1C(C3=C(N2)C(=C(C(=C3O)CC=C(C)C)O)CC=C(C)C)=O)O |
| InChI | 1S/C23H25NO4/c1-12(2)8-10-15-20-18(23(28)16(21(15)26)11-9-13(3)4)22(27)14-6-5-7-17(25)19(14)24-20/h5-9,25-26,28H,10-11H2,1-4H3,(H,24,27) |
| InChIKey | GLXYKTASIIUSRC-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.854°C at 760 mmHg (Cal.) |
| Flash point | 307.509°C (Cal.) |
| (1) | Hoong-Kun Fun, Chin Sing Yeap and Suchada Chantrapromma . Redetermination and absolute configuration of atalaphylline , Acta Cryst (2010). E66, o252-o253 Â Â |
|---|---|
| Market Analysis Reports |