| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | N,N'-Diphenyldicarbonimidic diamide |
|---|---|
| Synonyms | N,N'-Diphenyldicarbonimidic diamide # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.27 |
| CAS Registry Number | 28584-90-9 |
| SMILES | C1=CC=C(C=C1)NC(=O)NC(=O)NC2=CC=CC=C2 |
| InChI | 1S/C14H13N3O2/c18-13(15-11-7-3-1-4-8-11)17-14(19)16-12-9-5-2-6-10-12/h1-10H,(H3,15,16,17,18,19) |
| InChIKey | QCEAZVJAZBUHIY-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Refractive index | 1.688 (Cal.) |
| (1) | Q.-C. Yang, D.-M. Huang, H.-Y. Chen and Y.-Q. Tang. A 1:1 Molecular Complex of 1,5-Diphenylbiuret and Phenyl Carbamidonitrile, Acta Cryst. (1996). C52, 470-472 |
|---|---|
| Market Analysis Reports |