|
CAS#: 28923-90-2 Product: 1,1,2,2-Tetra-Tert-Butyl-Ethylene No suppilers available for the product. |
| Name | 1,1,2,2-Tetra-Tert-Butyl-Ethylene |
|---|---|
| Synonyms | 3-Tert-Butyl-2,2,5,5-Tetramethyl-Hex-3-Ene; 3-Hexene, 2,2,5,5-Tetramethyl-3,4-Bis(1,1-Dimethylethyl)-; ((Ch3)3C)2C=Chc(Ch3)3 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 |
| CAS Registry Number | 28923-90-2 |
| SMILES | CC(C=C(C(C)(C)C)C(C)(C)C)(C)C |
| InChI | 1S/C14H28/c1-12(2,3)10-11(13(4,5)6)14(7,8)9/h10H,1-9H3 |
| InChIKey | KJNUCVIKPVSPHV-UHFFFAOYSA-N |
| Density | 0.776g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.862°C at 760 mmHg (Cal.) |
| Flash point | 62.891°C (Cal.) |
| (1) | Cinzia Chiappe, Dieter Lenoir, Christian Silvio Pomelli and Roberto Bianchini. Influence of alkene structure on the stability of alkene–Br complexes: Effect of chlorine substitution, Phys. Chem. Chem. Phys., 2004, 6, 3235. |
|---|---|
| Market Analysis Reports |