|
CAS#: 2897-83-8 Product: Alonimide No suppilers available for the product. |
| Name | Alonimide |
|---|---|
| Synonyms | Spiro[Piperidine-3,4'-Tetralin]-1',2,6-Trione; D02828; 1,2,3,4-Tetrahydronaphthalin-1-Spiro-3'-Piperidin-4,2',6'-Dion |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 2897-83-8 |
| SMILES | C1=CC=CC3=C1C2(C(NC(=O)CC2)=O)CCC3=O |
| InChI | 1S/C14H13NO3/c16-11-5-7-14(8-6-12(17)15-13(14)18)10-4-2-1-3-9(10)11/h1-4H,5-8H2,(H,15,17,18) |
| InChIKey | WZAIVXXKOAWTGQ-UHFFFAOYSA-N |
| Density | 1.332g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.944°C at 760 mmHg (Cal.) |
| Flash point | 218.639°C (Cal.) |
| (1) | Basavaiah Deevi. Simple and facile synthesis of tetralone-spiro-glutarimides and spiro-bisglutarimides from Baylis�Hillman acetates, Organic & Biomolecular Chemistry, 2008 |
|---|---|
| Market Analysis Reports |