| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Organic raw materials >> Amino compound >> Cycloalkylamines, aromatic monoamines, aromatic polyamines and derivatives and salts |
|---|---|
| Name | 2,6-Diisopropyl-N,N-Dimethylaniline |
| Synonyms | 2,6-Diisopropyl-N,N-Dimethyl-Aniline; 2,6-Diisopropyl-N,N-Dimethylaniline; (2,6-Diisopropylphenyl)-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 |
| CAS Registry Number | 2909-77-5 |
| SMILES | C1=C(C(=C(C=C1)C(C)C)N(C)C)C(C)C |
| InChI | 1S/C14H23N/c1-10(2)12-8-7-9-13(11(3)4)14(12)15(5)6/h7-11H,1-6H3 |
| InChIKey | ALXIOUGHHXXLKX-UHFFFAOYSA-N |
| Density | 0.873 (Expl.) |
|---|---|
| 0.9±0.1g/cm3 (Cal.) | |
| Boiling point | 86°C (Expl.) |
| 263.3±29.0°C at 760 mmHg (Cal.) | |
| Flash point | 110°C (Expl.) |
| 106.8±17.2°C (Cal.) | |
| Refractive index | 1.5 (Expl.) |
| Safety Code | S9;S26;S36/37 Details |
|---|---|
| Risk Code | R20/21/22;R36/38 Details |
| Hazard Symbol | X Details |
| Transport Information | UN2810 |
| Safety Description | DANGER: POISON, irritates skin, eyes, lungs |
| SDS | Available |
| Market Analysis Reports |