|
CAS#: 2914-29-6 Product: 1,3,5,7-Tetranitro-1,3,5,7-Tetrazocane No suppilers available for the product. |
| Name | 1,3,5,7-Tetranitro-1,3,5,7-Tetrazocane |
|---|---|
| Synonyms | N,N-Dimethylmethanamide; 1,3,5,7-Tetranitro-1,3,5,7-Tetrazocane; Formamide, N,N-Dimethyl-, Compd. With Octahydro-1,3,5,7-Tetranitro-1,3,5,7-Tetrazocine (1:1); Octahydro-1,3,5,7-Tetranitro-1,3,5,7-Tetrazocine, Compound With N,N-Dimethylformamide (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15N9O9 |
| Molecular Weight | 369.25 |
| CAS Registry Number | 2914-29-6 |
| SMILES | O=[N+]([O-])N1CN([N+]([O-])=O)CN([N+]([O-])=O)CN([N+]([O-])=O)C1.CN(C=O)C |
| InChI | 1S/C4H8N8O8.C3H7NO/c13-9(14)5-1-6(10(15)16)3-8(12(19)20)4-7(2-5)11(17)18;1-4(2)3-5/h1-4H2;3H,1-2H3 |
| InChIKey | AAIMWVVYPGXYTB-UHFFFAOYSA-N |
| Boiling point | 906.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 501.8°C (Cal.) |
| Market Analysis Reports |