| Fenhe Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.fenhechem.com | |||
![]() | +86 (021) 3392-6068 | |||
![]() | julius.wei@fenhechem.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Chemical reagent >> Organic reagent >> Amide |
|---|---|
| Name | N-[4-(tert-butylsulfamoyl)phenyl]acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 |
| CAS Registry Number | 294885-56-6 |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC(C)(C)C |
| SDS | Available |
|---|---|
|
N-[4-(tert-Butylsulfamoyl)phenyl]acetamide is a chemical compound that has garnered attention due to its intriguing structure and potential applications in both medicinal and industrial chemistry. This compound features a sulfonamide group linked to a phenyl ring and an acetamide moiety, creating a versatile molecule with diverse uses. The discovery of N-[4-(tert-Butylsulfamoyl)phenyl]acetamide is part of ongoing research into sulfonamide derivatives, which are known for their broad spectrum of biological activities. The compound's structure includes a tert-butylsulfamoyl group, which provides steric bulk and influences the molecule's chemical reactivity, and a phenyl group, which can impact its interaction with biological targets. The acetamide group adds further functionality, making it a useful component in various chemical applications. In medicinal chemistry, N-[4-(tert-Butylsulfamoyl)phenyl]acetamide is explored for its potential as an antimicrobial agent. Sulfonamides are well-known for their antibacterial properties, and the addition of the tert-butylsulfamoyl group may enhance these properties or provide unique interactions with bacterial targets. Researchers are investigating its effectiveness against a range of pathogens, which could lead to the development of new antibiotics with improved efficacy and selectivity. Beyond its pharmaceutical potential, N-[4-(tert-Butylsulfamoyl)phenyl]acetamide is also used in industrial applications. The compound's ability to act as a versatile intermediate in chemical syntheses makes it valuable in the production of various organic materials. For instance, it can be employed in the synthesis of specialty polymers and resins, where its chemical stability and functional groups contribute to the desired properties of the final products. The unique combination of the tert-butylsulfamoyl group with the phenyl and acetamide functionalities allows N-[4-(tert-Butylsulfamoyl)phenyl]acetamide to participate in a range of chemical reactions. Its reactivity can be harnessed to develop new materials or modify existing ones, providing opportunities for innovation in both drug development and materials science. Overall, N-[4-(tert-Butylsulfamoyl)phenyl]acetamide is a compound with promising applications across various fields. Its structure and functional groups make it a valuable molecule for developing new therapeutic agents and advanced materials. As research progresses, it is likely to contribute to new discoveries and applications in chemistry and related disciplines. References none |
| Market Analysis Reports |