|
CAS#: 2958-05-6 Product: 3,12-Dioxo-5-beta-Cholan-24-Oic Acid No suppilers available for the product. |
| Name | 3,12-Dioxo-5-beta-Cholan-24-Oic Acid |
|---|---|
| Synonyms | (4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-3,12-Diketo-10,13-Dimethyl-2,4,5,6,7,8,9,11,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl]Valeric Acid; 5Beta-Cholan-24-Oic Acid, 3,12-Dioxo- (8Ci); 3,12-Diketo-5Beta-Cholanic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 |
| CAS Registry Number | 2958-05-6 |
| EINECS | 220-982-6 |
| SMILES | [C@]34([C@H]([C@H]2[C@@H]([C@@]1([C@@H](CC(=O)CC1)CC2)C)CC3=O)CC[C@@H]4[C@@H](CCC(=O)O)C)C |
| InChI | 1S/C24H36O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-15,17-20H,4-13H2,1-3H3,(H,27,28)/t14-,15-,17+,18-,19+,20+,23+,24-/m1/s1 |
| InChIKey | XNTYYYINMGRBQW-ZEZONBOOSA-N |
| Density | 1.12g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.668°C at 760 mmHg (Cal.) |
| Flash point | 297.27°C (Cal.) |
| (1) | E. M. Kikolski, M. Davison, R. A. Lalancette and H. W. Thompson. (+)-3,12-Dioxo-5[beta]-cholanic acid: hydrogen bonding in a diketo bile-acid derivative, Acta Cryst. (2006). E62, o2641-o2643 |
|---|---|
| Market Analysis Reports |