| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | Penicillamine Methyl Ester |
|---|---|
| Synonyms | Methyl (2R)-2-Amino-3-Methyl-3-Sulfanyl-Butanoate; (2R)-2-Amino-3-Mercapto-3-Methylbutanoic Acid Methyl Ester; (2R)-2-Amino-3-Mercapto-3-Methyl-Butyric Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.23 |
| CAS Registry Number | 29913-83-5 (34297-27-3) |
| SMILES | [C@H](C(=O)OC)(N)C(C)(C)S |
| InChI | 1S/C6H13NO2S/c1-6(2,10)4(7)5(8)9-3/h4,10H,7H2,1-3H3/t4-/m1/s1 |
| InChIKey | FIXGPNLTDAUQQF-SCSAIBSYSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 207.946°C at 760 mmHg (Cal.) |
| Flash point | 79.563°C (Cal.) |
| (1) | Mamoru Haratake, Tsunanori Sakano, Takeshi Fuchigami and Morio Nakayama. Thiol-targeted introduction of selenocysteine to polypeptides for synthesis of glutathione peroxidase mimics, Metallomics, 2011, 3, 702. |
|---|---|
| Market Analysis Reports |