| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Trans World Chemicals, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (301) 279-2295 | |||
![]() |
transworldchems@aol.com | |||
| Chemical manufacturer since 1974 | ||||
| Name | Ethyl 1-Naphthoate |
|---|---|
| Synonyms | 1-Naphthalenecarboxylic Acid Ethyl Ester; Naphthalene-1-Carboxylic Acid Ethyl Ester; Ethyl 1-Naphthoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 |
| CAS Registry Number | 3007-97-4 |
| EINECS | 221-120-1 |
| SMILES | C1=CC=CC2=CC=CC(=C12)C(OCC)=O |
| InChI | 1S/C13H12O2/c1-2-15-13(14)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| InChIKey | XCTLDQQOHIEUCJ-UHFFFAOYSA-N |
| Density | 1.11 (Expl.) |
|---|---|
| 1.1±0.1g/cm3 (Cal.) | |
| Boiling point | 309.999°C at 760 mmHg (Cal.) |
| 308-310°C (Expl.) | |
| Flash point | 148.7±4.0°C (Cal.) |
| Refractive index | 1.593 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |