|
CAS#: 30143-51-2 Product: 1-Ethenyl-2-Phenylbenzene No suppilers available for the product. |
| Name | 1-Ethenyl-2-Phenylbenzene |
|---|---|
| Synonyms | 1-Phenyl-2-Vinyl-Benzene; 1-Phenyl-2-Vinylbenzene; 1-Ethenyl-2-Phenyl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 |
| CAS Registry Number | 30143-51-2 |
| SMILES | C2=C(C1=CC=CC=C1)C(=CC=C2)C=C |
| InChI | 1S/C14H12/c1-2-12-8-6-7-11-14(12)13-9-4-3-5-10-13/h2-11H,1H2 |
| InChIKey | XIRPMPKSZHNMST-UHFFFAOYSA-N |
| Density | 0.998g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.26°C at 760 mmHg (Cal.) |
| Flash point | 143.664°C (Cal.) |
| (1) | Nicolas R. Vautravers, Pascal André and David J. Cole-Hamilton. Fluorescence activation of a polyhedral oligomeric silsesquioxane in the presence of reducing agents, J. Mater. Chem., 2009, 19, 4545. |
|---|---|
| Market Analysis Reports |