| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 1,8-Diphenyl-1,3,5,7-Octatetraene |
|---|---|
| Synonyms | [(1E,3E,5E,7E)-8-Phenylocta-1,3,5,7-Tetraenyl]Benzene; Benzene, 1,1'-(1,3,5,7-Octatetraene-1,8-Diyl)Bis-, (All-E)-; St5412064 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 |
| CAS Registry Number | 3029-40-1 |
| EINECS | 221-198-7 |
| SMILES | C2=C(/C=C/C=C/C=C/C=C/C1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C20H18/c1(3-7-13-19-15-9-5-10-16-19)2-4-8-14-20-17-11-6-12-18-20/h1-18H/b3-1+,4-2+,13-7+,14-8+ |
| InChIKey | ZENGMMQJMCPHTK-FPPPDJHPSA-N |
| Density | 1.023g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.874°C at 760 mmHg (Cal.) |
| Flash point | 250.21°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | V. Ramamurthy, J. Shailaja, Lakshmi S. Kaanumalle, R. B. Sunoj and J. Chandrasekhar. Controlling chemistry with cations: photochemistry within zeolites, Chem. Commun., 2003, 0, 1987. |
|---|---|
| Market Analysis Reports |