|
CAS#: 30351-73-6 Product: 2-methyl-2-Propenoic acid polymer with ethyl 2-propenoate and 2-propenoic acid No suppilers available for the product. |
| Name | 2-methyl-2-Propenoic acid polymer with ethyl 2-propenoate and 2-propenoic acid |
|---|---|
| Synonyms | Acrylic Acid; Ethyl Prop-2-Enoate; 2-Methylprop-2-Enoic Acid; Acrylic Acid; 2-Methylprop-2-Enoic Acid; Prop-2-Enoic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 |
| CAS Registry Number | 30351-73-6 |
| SMILES | C(OC(=O)C=C)C.CC(C(=O)O)=C.O=C(O)C=C |
| InChI | 1S/C5H8O2.C4H6O2.C3H4O2/c1-3-5(6)7-4-2;1-3(2)4(5)6;1-2-3(4)5/h3H,1,4H2,2H3;1H2,2H3,(H,5,6);2H,1H2,(H,4,5) |
| InChIKey | PHXUXIXKBHUYCF-UHFFFAOYSA-N |
| Boiling point | 99.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 15.6°C (Cal.) |
| Market Analysis Reports |