| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Paragos e. K. | Germany | |||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-Ethynylnaphthalene |
|---|---|
| Synonyms | 1-ethynyl-naphthalene; InChI=1/C12H8/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h1,3-9H; 557927_ALDRICH |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8 |
| Molecular Weight | 152.19 |
| CAS Registry Number | 304905-17-7 |
| SMILES | C#CC1=CC=CC2=CC=CC=C21 |
| InChI | 1S/C12H8/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h1,3-9H |
| InChIKey | MCZUXEWWARACSP-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.4±9.0°C at 760 mmHg (Cal.) |
| Flash point | 106.3±12.9°C (Cal.) |
| Refractive index | 1.644 (Cal.) |
| (1) | Raymond J. Abraham and Matthew Reid. Proton chemical shifts in NMR. Part 16. Proton chemical shifts in acetylenes and the anisotropic and steric effects of the acetylene group, J. Chem. Soc., Perkin Trans. 2, 2001, 0, 1195. |
|---|---|
| Market Analysis Reports |