|
CAS#: 3079-01-4 Product: Diethyl (3-Sulfamoylphenyl) Phosphate No suppilers available for the product. |
| Name | Diethyl (3-Sulfamoylphenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Diethyl (3-Sulfamoylphenyl) Ester; Phosphoric Acid, Diethyl Ester, Ester With M-Hydroxybenzenesulfonamide; Brn 2704857 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16NO6PS |
| Molecular Weight | 309.27 |
| CAS Registry Number | 3079-01-4 |
| SMILES | C1=C(O[P](=O)(OCC)OCC)C=CC=C1[S](N)(=O)=O |
| InChI | 1S/C10H16NO6PS/c1-3-15-18(12,16-4-2)17-9-6-5-7-10(8-9)19(11,13)14/h5-8H,3-4H2,1-2H3,(H2,11,13,14) |
| InChIKey | MYMPLHOTCNWXKA-UHFFFAOYSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.758°C at 760 mmHg (Cal.) |
| Flash point | 210.686°C (Cal.) |
| Market Analysis Reports |