|
CAS#: 30900-72-2 Product: 2-Propenoic acid ethyl ester, polymer with ethenyl acetate and 2-ethylhexyl 2-propenoate No suppilers available for the product. |
| Name | 2-Propenoic acid ethyl ester, polymer with ethenyl acetate and 2-ethylhexyl 2-propenoate |
|---|---|
| Synonyms | 2-Ethylhexyl Prop-2-Enoate; Ethyl Prop-2-Enoate; Vinyl Acetate; Acetic Acid Vinyl Ester; Prop-2-Enoic Acid Ethyl Ester; Prop-2-Enoic Acid 2-Ethylhexyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 |
| CAS Registry Number | 30900-72-2 |
| SMILES | C(OC(=O)C=C)C(CCCC)CC.C(OC(=O)C=C)C.CC(OC=C)=O |
| InChI | 1S/C11H20O2.C5H8O2.C4H6O2/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-3-5(6)7-4-2;1-3-6-4(2)5/h6,10H,3-5,7-9H2,1-2H3;3H,1,4H2,2H3;3H,1H2,2H3 |
| InChIKey | RNCTXGAVFNEMNS-UHFFFAOYSA-N |
| Boiling point | 216°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 79.4°C (Cal.) |
| Market Analysis Reports |