| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Name | (1R,2R,3S,4R,6S)-4,6-Diamino-2,3-Dihydroxycyclohexyl 6-Amino-6-Deoxy-alpha-D-Glucopyranoside |
|---|---|
| Synonyms | (1R,2R,3S |
| Molecular Structure | ![]() |
| Molecular Formula | C12H25N3O7 |
| Molecular Weight | 323.34 |
| CAS Registry Number | 31077-71-1 |
| SMILES | O([C@H]1[C@H](O)[C@@H](O)[C@H](N)C[C@@H]1N)[C@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CN |
| InChI | 1S/C12H25N3O7/c13-2-5-7(17)8(18)10(20)12(21-5)22-11-4(15)1-3(14)6(16)9(11)19/h3-12,16-20H,1-2,13-15H2/t3-,4+,5-,6+,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | AWRLKTYNEGEURZ-JCLMPDJQSA-N |
| Density | 1.568g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.077°C at 760 mmHg (Cal.) |
| Flash point | 304.015°C (Cal.) |
| (1) | Park et al.. Discovery of parallel pathways of kanamycin biosynthesis allows antibiotic manipulation, Nature Chemical Biology, 2011 |
|---|---|
| Market Analysis Reports |