| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl Perfluorooctanoate |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctanoic Acid Ethyl Ester; 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorocaprylic Acid Ethyl Ester; Ethyl Perfluorooctanonate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5F15O2 |
| Molecular Weight | 442.12 |
| CAS Registry Number | 3108-24-5 |
| EINECS | 221-468-4 |
| SMILES | C(OC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)=O)C |
| InChI | 1S/C10H5F15O2/c1-2-27-3(26)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)25/h2H2,1H3 |
| InChIKey | JTOFFHFAQBLPTM-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| 1.626 (Expl.) | |
| Boiling point | 167.499°C at 760 mmHg (Cal.) |
| 167-168°C (Expl.) | |
| Flash point | 58.3±20.8°C (Cal.) |
| Refractive index | 1.311 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |