| MicroCombiChem e.K. | UK | |||
|---|---|---|---|---|
![]() |
+49 (611) 962-5284 | |||
![]() |
info@microcombichem.com | |||
| Chemical manufacturer | ||||
| Name | 2,3,5,6-Tetramethoxycyclohexa-2,5-Diene-1,4-Dione |
|---|---|
| Synonyms | 2,3,5,6-Tetramethoxy-1,4-Benzoquinone; 2,3,5,6-Tetramethoxy-P-Benzoquinone; Nsc92665 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 |
| CAS Registry Number | 3117-06-4 |
| SMILES | COC1=C(OC)C(=O)C(=C(C1=O)OC)OC |
| InChI | 1S/C10H12O6/c1-13-7-5(11)9(15-3)10(16-4)6(12)8(7)14-2/h1-4H3 |
| InChIKey | NGVNNMUSBYNCMR-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.139°C at 760 mmHg (Cal.) |
| Flash point | 206.258°C (Cal.) |
| (1) | Gaëtan Bonnard, Anne-Lise Barrès, Yann Danten, Damian G. Allis, Olivier Mentré, Daniele Tomerini, Carlo Gatti, Ekaterina I. Izgorodina, Philippe Poizot and Christine Frayret. Experimental and theoretical studies of tetramethoxy-p-benzoquinone: infrared spectra, structural and lithium insertion properties, RSC Advances, 2013, . |
|---|---|
| Market Analysis Reports |