| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Avistron Chemistry Services Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (7896) 979-531 | |||
![]() |
sales@avistronchemistry.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 5-Phenyl-2-Pyrimidinamine |
|---|---|
| Synonyms | 2-Amino-5-phenylpyrimidine; 5-Phenyl-pyrimidin-2-ylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 |
| CAS Registry Number | 31408-23-8 |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=C2)N |
| InChI | 1S/C10H9N3/c11-10-12-6-9(7-13-10)8-4-2-1-3-5-8/h1-7H,(H2,11,12,13) |
| InChIKey | JYGOFGJNWGAPAN-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.9±38.0°C at 760 mmHg (Cal.) |
| Flash point | 228.3±14.0°C (Cal.) |
| (1) | Ion Stoll, Ralf Brodbeck, Beate Neumann, Hans-Georg Stammler and Jochen Mattay. Controlling the self assembly of arene functionalised 2-aminopyrimidines by arene-perfluoroarene interaction and by silver(I) complex formation, CrystEngComm, 2009, 11, 306. |
|---|---|
| Market Analysis Reports |