| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1-Butyl-3-Phenylsulfonylurea |
|---|---|
| Synonyms | 1-Butyl-3-Phenylsulfonyl-Urea; 4-11-00-00074 (Beilstein Handbook Reference); Brn 2217201 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.32 |
| CAS Registry Number | 3149-00-6 |
| EINECS | 221-578-2 |
| SMILES | C1=C([S](NC(NCCCC)=O)(=O)=O)C=CC=C1 |
| InChI | 1S/C11H16N2O3S/c1-2-3-9-12-11(14)13-17(15,16)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H2,12,13,14) |
| InChIKey | AFOGBLYPWJJVAL-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |