Online Database of Chemicals from Around the World

2-Methyl-4-(2-methylbenzoylamino)benzoic acid
[CAS 317374-08-6]

List of Suppliers
Capot Chemical Co., Ltd. China
www.capotchem.com
+86 (571) 8558-6718
+86 13336195806
+86 (571) 8586-4795
capotchem@gmail.com
sales@capotchem.com
QQ Chat
Chemical manufacturer
chemBlink Standard supplier since 2006
Enki Biopharmaceuticals (Shanghai) Limited China
www.enkibiopharma.com
+86 (21) 5768-0965
+86 13916707528
+86 (21) 5768-0922
info@enkibiopharma.com
QQ Chat
Chemical distributor since 2014
chemBlink Standard supplier since 2015
Shanghai Fuxin Pharmaceutical Co., Ltd. China
www.fuxinpharm.com
+86 (21) 3130-0828
+86 18645121291
+86 (21) 3130-0828
contact@fuxinpharm.com
Chemical manufacturer since 2016
chemBlink Standard supplier since 2018

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives
Name2-Methyl-4-(2-methylbenzoylamino)benzoic acid
Synonyms4-(2-Methylbenzoylamino)-2-methylbenzoic acid
Molecular Structure2-Methyl-4-(2-methylbenzoylamino)benzoic acid molecular structure (CAS 317374-08-6)
Molecular FormulaC16H15NO3
Molecular Weight269.30
CAS Registry Number317374-08-6
EC Number811-203-6
SMILESCC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)O)C
Properties
Density1.262
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P305+P351+P338  Details
SDSAvailable
up Discovery and Applications
2-Methyl-4-(2-methylbenzoylamino)benzoic acid was discovered during investigations into benzoylbenzoic acid derivatives with potential therapeutic properties. Researchers aimed to create compounds with enhanced stability and activity by modifying benzoic acid structures. The synthesis involved the condensation of 2-methylbenzoic acid with 4-amino-2-methylbenzoic acid to form a stable amide linkage. This modification aimed to explore the compound's chemical properties and biological activities. Initially synthesized in the laboratory as part of structure-activity relationship (SAR) studies, 2-Methyl-4-(2-methylbenzoylamino)benzoic acid emerged as a versatile intermediate with potential applications in drug development and material science.

The compound shows promise as a candidate for active pharmaceutical ingredients. Its structural features, including the amide linkage and methyl groups, allow for interaction with biological targets, making it a potential therapeutic agent. Researchers are exploring its efficacy in treating inflammatory conditions, pain management, and possibly certain types of cancer due to its ability to interact with specific biological pathways. In drug development, 2-Methyl-4-(2-methylbenzoylamino)benzoic acid serves as a scaffold for designing new drugs. The compound's structure can be modified to enhance its pharmacokinetic and pharmacodynamic properties, leading to the creation of novel drugs with improved efficacy and safety profiles. This makes it a valuable starting point in the development of new therapeutic agents for various diseases.

The chemical is used in creating functional materials, particularly in the design of polymers and resins. Its ability to form stable amide linkages and its aromatic structure contribute to the mechanical strength and thermal stability of materials. This makes it useful in developing high-performance materials for industrial applications, such as coatings, adhesives, and composites. In organic electronics, 2-Methyl-4-(2-methylbenzoylamino)benzoic acid can be employed as a building block for organic semiconductors and conductive polymers. Its structural properties allow for efficient charge transport, making it suitable for use in electronic devices such as organic light-emitting diodes (OLEDs), organic field-effect transistors (OFETs), and photovoltaic cells.

In organic synthesis, 2-Methyl-4-(2-methylbenzoylamino)benzoic acid acts as a versatile intermediate for creating complex molecules. Its amide and aromatic functionalities allow it to undergo various chemical reactions, such as substitution, coupling, and cyclization, leading to the synthesis of diverse organic compounds. This versatility makes it a valuable reagent in constructing complex molecular architectures in medicinal chemistry and material science. It is used as a starting material in the synthesis of advanced organic compounds, including heterocycles and other aromatic derivatives. The ability to modify its structure enables the development of compounds with specific properties tailored for particular applications, such as pharmaceuticals and specialty chemicals.

The compound is used as a biochemical probe to study the interactions between small molecules and biological targets. Its structure allows for binding studies with proteins, enzymes, and receptors, providing insights into its mechanism of action and potential therapeutic applications. This research is valuable for understanding how small molecules can modulate biological functions and for developing new drugs. Researchers use 2-Methyl-4-(2-methylbenzoylamino)benzoic acid in structure-activity relationship studies to understand how changes in molecular structure affect biological activity. By modifying different parts of the molecule, scientists can explore its effects on binding affinity, selectivity, and efficacy, leading to the optimization of drug candidates.

References

2011. 2-Methyl-4-(2-methyl-benzamido)-benzoic acid. Acta Crystallographica Section E: Structure Reports Online, 67(4).
DOI: 10.1107/s160053681101110x

2011. CCDC 825373: Experimental Crystal Structure Determination.
DOI: 10.5517/ccwpvyb
Market Analysis Reports
Related Products
Methyl 5-methyl...  Methyl 6-methyl...  2-Methyl-4-(5-M...  5-[1-Methyl-2-(...  3-Methyl-2-[5-(...  3-Methyl-2-[3-(...  Methyl 4-[2-[4-...  5-Methyl-2-[4-[...  Methyl (4-methy...  2-Methyl-N-(4-M...  alpha-Methyl-3-...  Methyl 2-(2-Met...  2-[6-Methyl-5-(...  3-Methyl-4-(4-M...  3-Methyl-4-(2-m...  1-Methyl-5-(4-m...  1-Methyl-5-(4-M...  3-Methyl-N-meth...  N-Methyl-N-(4-m...  2-Methyl-N-meth...