|
CAS#: 31892-68-9 Product: 5-Methyl-4-phenylthiazole 1,2-ethanedisulfonate (2:1) No suppilers available for the product. |
| Name | 5-Methyl-4-phenylthiazole 1,2-ethanedisulfonate (2:1) |
|---|---|
| Synonyms | Ethane-1,2-Disulfonic Acid; 5-Methyl-4-Phenyl-Thiazole; Ethane-1,2-Disulfonic Acid; 5-Methyl-4-Phenylthiazole; 1,2-Ethanedisulfonic Acid, Compd. With 5-Methyl-4-Phenylthiazole (1:2) |
| Molecular Structure | ![]() |
| Molecular Formula | C22H24N2O6S4 |
| Molecular Weight | 540.68 |
| CAS Registry Number | 31892-68-9 |
| SMILES | C1=NC(=C(S1)C)C2=CC=CC=C2.C3=NC(=C(S3)C)C4=CC=CC=C4.C([S](=O)(=O)O)C[S](=O)(=O)O |
| InChI | 1S/2C10H9NS.C2H6O6S2/c2*1-8-10(11-7-12-8)9-5-3-2-4-6-9;3-9(4,5)1-2-10(6,7)8/h2*2-7H,1H3;1-2H2,(H,3,4,5)(H,6,7,8) |
| InChIKey | PPKISWROWJRDRF-UHFFFAOYSA-N |
| Boiling point | 277.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 126.7°C (Cal.) |
| Market Analysis Reports |