|
CAS#: 32055-14-4 Product: Benzenamine, polymer with carbonic dichloride and formaldehyde No suppilers available for the product. |
| Name | Benzenamine, polymer with carbonic dichloride and formaldehyde |
|---|---|
| Synonyms | Formaldehyde; Phenylamine; Phosgene; Aniline; Carbonyl Dichloride; Methanal |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9Cl2NO2 |
| Molecular Weight | 222.07 |
| CAS Registry Number | 32055-14-4 |
| SMILES | C1=CC=CC=C1N.O=C(Cl)Cl.O=C |
| InChI | 1S/C6H7N.CCl2O.CH2O/c7-6-4-2-1-3-5-6;2-1(3)4;1-2/h1-5H,7H2;;1H2 |
| InChIKey | BBTBDWHKOCOVAQ-UHFFFAOYSA-N |
| Boiling point | 184.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 70°C (Cal.) |
| Market Analysis Reports |