| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Chemodex Ltd. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 244-4825 | |||
![]() |
info@chemodex.com | |||
| Chemical distributor | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-(4,6-Dichloro-1,3,5-Triazin-2-Yl)Pyrene |
|---|---|
| Synonyms | 2,4-Dichloro-6-(1-Pyrenyl)-1,3,5-Triazine; 2,4-Dichloro-6-Pyren-1-Yl-S-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H9Cl2N3 |
| Molecular Weight | 350.21 |
| CAS Registry Number | 3224-36-0 |
| EINECS | 221-754-9 |
| SMILES | C1=CC4=C3C2=C1C(=CC=C2C=CC3=CC=C4)C5=NC(=NC(=N5)Cl)Cl |
| InChI | 1S/C19H9Cl2N3/c20-18-22-17(23-19(21)24-18)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| InChIKey | ZDMAOBNCIJTNCB-UHFFFAOYSA-N |
| Density | 1.517g/cm3 (Cal.) |
|---|---|
| Boiling point | 628.397°C at 760 mmHg (Cal.) |
| Flash point | 359.309°C (Cal.) |
| (1) | Johan Mattsson, Olivier Zava, Anna K. Renfrew, Yoshihisa Sei, Kentaro Yamaguchi, Paul J. Dyson and Bruno Therrien. Drug delivery of lipophilic pyrenyl derivatives by encapsulation in a water soluble metalla-cage, Dalton Trans., 2010, 39, 8248. |
|---|---|
| Market Analysis Reports |