| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | 6-Nitro-2-Naphthalenamine |
|---|---|
| Synonyms | 6-Nitro-2-naphthalenamine #; 6-Nitronaphthalen-2-amine; AIDS019464 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18 |
| CAS Registry Number | 3230-35-1 |
| SMILES | C1=CC2=C(C=CC(=C2)[N+](=O)[O-])C=C1N |
| InChI | 1S/C10H8N2O2/c11-9-3-1-8-6-10(12(13)14)4-2-7(8)5-9/h1-6H,11H2 |
| InChIKey | LNYJXDMWSMEVGQ-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.5±18.0°C at 760 mmHg (Cal.) |
| Flash point | 198.5±21.2°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |