| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Cbz-Ala-Gly-OH |
|---|---|
| Synonyms | 2-[[1-Oxo-2-[[Oxo-(Phenylmethoxy)Methyl]Amino]Propyl]Amino]Acetic Acid; 2-[2-(Benzyloxycarbonylamino)Propanoylamino]Acetic Acid; 2-[2-(Phenylmethoxycarbonylamino)Propanoylamino]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 |
| CAS Registry Number | 3235-17-4 |
| EINECS | 221-791-0 |
| SMILES | C1=CC=CC=C1COC(NC(C(NCC(O)=O)=O)C)=O |
| InChI | 1S/C13H16N2O5/c1-9(12(18)14-7-11(16)17)15-13(19)20-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,18)(H,15,19)(H,16,17) |
| InChIKey | RNBMQRYMCAVZPN-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.49°C at 760 mmHg (Cal.) |
| Flash point | 303.66°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Powers RA, Morandi F, Shoichet BK. Structure-based discovery of a novel, noncovalent inhibitor of AmpC beta-lactamase., Structure. 2002 Jul;10(7):1013-23 |
|---|---|
| Market Analysis Reports |