| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,3-Diethylpyrimidine-2,4,6(1H,3H,5H)-Trione |
|---|---|
| Synonyms | 1,3-Diethylhexahydropyrimidine-2,4,6-Trione; 1,3-Diethylbarbituric Acid; Zinc02574922 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 |
| CAS Registry Number | 32479-73-5 |
| EINECS | 251-064-3 |
| SMILES | C(N1C(N(C(=O)CC1=O)CC)=O)C |
| InChI | 1S/C8H12N2O3/c1-3-9-6(11)5-7(12)10(4-2)8(9)13/h3-5H2,1-2H3 |
| InChIKey | XUCMDLYIYOXEBF-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.878°C at 760 mmHg (Cal.) |
| Flash point | 107.426°C (Cal.) |
| (1) | Valerio Bertolasi, Paola Gilli, Valeria Ferretti and Gastone Gilli. Competition between hydrogen bonding and donor–acceptor interactions in co-crystals of 1,3-dimethylbarbituric acid with aromatic amines, New J. Chem., 2001, 25, 408. |
|---|---|
| Market Analysis Reports |