| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Cobalt succinate |
|---|---|
| Synonyms | Cobaltous Butanedioate; Cobaltous Succinate; Butanedioic Acid, Cobalt(2+) Salt (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4CoO4 |
| Molecular Weight | 175.01 |
| CAS Registry Number | 3267-76-3 |
| EINECS | 221-878-3 |
| SMILES | C(C([O-])=O)CC([O-])=O.[Co++] |
| InChI | 1S/C4H6O4.Co/c5-3(6)1-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);/q;+2/p-2 |
| InChIKey | XENHXPKUQLUHCZ-UHFFFAOYSA-L |
| Boiling point | 236.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.9°C (Cal.) |
| (1) | Paul M. Forster, Andrea R. Burbank, Carine Livage, Gérard Férey and Anthony K. Cheetham. The role of temperature in the synthesis of hybrid inorganic–organic materials: the example of cobalt succinates, Chem. Commun., 2004, 0, 368. |
|---|---|
| Market Analysis Reports |