| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Propylene glycol, maleic anhydride, dicyclopentadiene polymer |
|---|---|
| Synonyms | 2,5-Furandione, Polymer With 1,2-Propanediol And 3A,4,7,7A-Tetrahydro-4,7-Methano-1H-Indene; Propylene Glycol, Maleic Anhydride, Dicyclopentadiene; Propylene Glycol, Maleic Anhydride, Dicyclopentadiene Polymer |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 |
| CAS Registry Number | 32677-47-7 |
| SMILES | O=C1OC(=O)C=C1.C(O)C(O)C.C4C2C(C3CC2C=C3)C=C4 |
| InChI | 1S/C10H12.C4H2O3.C3H8O2/c1-2-9-7-4-5-8(6-7)10(9)3-1;5-3-1-2-4(6)7-3;1-3(5)2-4/h1-2,4-5,7-10H,3,6H2;1-2H;3-5H,2H2,1H3 |
| InChIKey | KCRQNTINBSSIMH-UHFFFAOYSA-N |
| Boiling point | 170°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 46.8°C (Cal.) |
| Market Analysis Reports |