| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 7-Bromobenz[a]Anthracene |
|---|---|
| Synonyms | Aids-017537; Benz[A]Anthracene, 7-Bromo-; Nsc30995 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H11Br |
| Molecular Weight | 307.19 |
| CAS Registry Number | 32795-84-9 |
| SMILES | C1=C3C(=C(Br)C2=C1C=CC=C2)C=CC4=C3C=CC=C4 |
| InChI | 1S/C18H11Br/c19-18-15-8-4-2-6-13(15)11-17-14-7-3-1-5-12(14)9-10-16(17)18/h1-11H |
| InChIKey | LGRNWCDRODWMOH-UHFFFAOYSA-N |
| Density | 1.477g/cm3 (Cal.) |
|---|---|
| Melting point | 152°C (Expl.) |
| Boiling point | 482.944°C at 760 mmHg (Cal.) |
| Flash point | 244.678°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Jian-Lin Sun, Hong-Gang Ni and Hui Zeng. Occurrence of chlorinated and brominated polycyclic aromatic hydrocarbons in surface sediments in Shenzhen, South China and its relationship to urbanization, J. Environ. Monit., 2011, 13, 2775. |
|---|---|
| Market Analysis Reports |