| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Zhengzhou Versailles-special Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (371) 6799-1738 | |||
![]() |
aurora2074@hotmail.com | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-1-(2-Methylnaphthalen-1-Yl)Naphthalene |
|---|---|
| Synonyms | 2-Methyl-1-(2-Methyl-1-Naphthyl)Naphthalene; 2,2'-Dimethyl-1,1'-Binaphthalene; 2,2'-Dimethyl-1,1'-Binaphthyl |
| Molecular Structure | ![]() |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.38 |
| CAS Registry Number | 32834-84-7 |
| SMILES | C1=CC=C2C(=C1)C(=C(C=C2)C)C4=C3C=CC=CC3=CC=C4C |
| InChI | 1S/C22H18/c1-15-11-13-17-7-3-5-9-19(17)21(15)22-16(2)12-14-18-8-4-6-10-20(18)22/h3-14H,1-2H3 |
| InChIKey | KDHFKMDVFWYSPT-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Melting point | 84°C (Expl.) |
| Boiling point | 401.817°C at 760 mmHg (Cal.) |
| Flash point | 192.274°C (Cal.) |
| (1) | Gennaro Pescitelli, Lorenzo Di Bari and Nina Berova. Conformational aspects in the studies of organic compounds by electronic circular dichroism, Chem. Soc. Rev., 2011, 40, 4603. |
|---|---|
| Market Analysis Reports |