| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Adipic Acid, Compound With Hexane-1,6-Diamine (1:1) |
|---|---|
| Synonyms | Adipic Acid; Hexane-1,6-Diamine; Adipic Acid; 6-Aminohexylamine; Hexanedioic Acid, Compd. With 1,6-Hexanediamine (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 |
| CAS Registry Number | 3323-53-3 |
| EINECS | 222-037-3 |
| SMILES | C(C(=O)O)CCCC(=O)O.C(CCCN)CCN |
| InChI | 1S/C6H16N2.C6H10O4/c7-5-3-1-2-4-6-8;7-5(8)3-1-2-4-6(9)10/h1-8H2;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | UFFRSDWQMJYQNE-UHFFFAOYSA-N |
| Boiling point | 338.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 172.7°C (Cal.) |
| Market Analysis Reports |