| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Name | 6-Pyridin-4-Yl-1,3,5-Triazine-2,4-Diamine |
|---|---|
| Synonyms | 6-(4-Pyridyl)-1,3,5-Triazine-2,4-Diamine; [4-Amino-6-(4-Pyridyl)-S-Triazin-2-Yl]Amine; S-Triazine, 2,4-Diamino-6-(4-Pyridyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N6 |
| Molecular Weight | 188.19 |
| CAS Registry Number | 33237-20-6 |
| EINECS | 251-415-0 |
| SMILES | C2=C(C1=NC(=NC(=N1)N)N)C=CN=C2 |
| InChI | 1S/C8H8N6/c9-7-12-6(13-8(10)14-7)5-1-3-11-4-2-5/h1-4H,(H4,9,10,12,13,14) |
| InChIKey | OCBCFXNEEQDQGV-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.854°C at 760 mmHg (Cal.) |
| Flash point | 324.862°C (Cal.) |
| (1) | Daniel Shiu-Hin ChanThese authors contributed equally to this work., Ho-Man Lee, Chi-Ming Che, Chung-Hang Leung and Dik-Lung Ma. A selective oligonucleotide-based luminescent switch-on probe for the detection of nanomolar mercury(ii) in aqueous solution, Chem. Commun., 2009, 7479. |
|---|---|
| Market Analysis Reports |