| Hangzhou Verychem Science And Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.verychem.com | |||
![]() | +86 (571) 8816-2785 +86 13606544505 | |||
![]() | +86 (571) 8816-2787 | |||
![]() | lucy@verychem.com | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink Massive supplier since 2021 | ||||
| Capot Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.capotchem.com | |||
![]() | +86 (571) 8558-6718 +86 13336195806 | |||
![]() | +86 (571) 8586-4795 | |||
![]() | capotchem@gmail.com sales@capotchem.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2006 | ||||
| Hangzhou Utanpharma Biology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.utanpharma.com | |||
![]() | +86 (571) 8682-1378 8682-0258 5683-6287 5683-6288 | |||
![]() | +86 (571) 8682-1328 | |||
![]() | sales@utanpharma.com utansale@hotmail.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() | www.synquestlabs.com | |||
![]() | +1 (386) 462-0788 | |||
![]() | +1 (386) 462-7097 | |||
![]() | Sales@synquestlabs.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2011 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() | www.biosynth.com | |||
![]() | +41 (71) 858-2020 | |||
![]() | +41 (71) 858-2030 | |||
![]() | welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2014 | ||||
| Apollo Scientific Ltd. | UK | |||
|---|---|---|---|---|
![]() | www.apolloscientific.co.uk | |||
![]() | +44 (161) 406-0505 | |||
![]() | +44 (161) 406-0506 | |||
![]() | sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Triazines |
|---|---|
| Name | 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.26 |
| CAS Registry Number | 33509-43-2 |
| EC Number | 251-548-4 |
| SMILES | CC(C)(C)C1=NNC(=S)N(C1=O)N |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.657, Calc.* |
| Boiling Point | 284.7±23.0 °C (760 mmHg), Calc.* |
| Flash Point | 126.0±22.6 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P280-P305+P351+P338 Details |
| SDS | Available |
|
4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one is a chemical compound with a distinct molecular structure featuring a triazine ring substituted with amino, mercapto, and tert-butyl groups. This compound is known for its potential applications in both organic synthesis and material science. It belongs to the class of triazine derivatives, which are important due to their varied reactivity and utility in different chemical processes. The compound has been explored for its role as a building block in the synthesis of more complex organic molecules. The presence of the amino group and the mercapto group provides potential for nucleophilic reactions, making the compound useful in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The triazine ring structure offers a stable framework that can support diverse functional groups, making it versatile in various synthetic pathways. In the field of pharmaceuticals, 4-amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one has been of interest for its potential as an intermediate or scaffold for drug design. The compound's reactivity, due to the presence of both amino and mercapto groups, allows for the formation of various derivatives that might possess biological activity. The triazine ring is known for its ability to interact with biological systems, which has prompted research into the compound’s potential as an active ingredient in therapeutic applications. Additionally, the compound’s tert-butyl group contributes to its lipophilicity, which can influence its solubility and stability in organic solvents, further extending its use in chemical reactions and formulations. This feature is particularly beneficial in applications that require compounds to remain stable under harsh conditions or in non-polar environments. 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one has also been studied in the context of material science. The stability and electronic properties imparted by the triazine ring, along with the mercapto group, make it suitable for inclusion in materials that require specific chemical resistance or conductivity. These properties allow it to be explored as part of specialty materials used in electronics or coatings. In summary, 4-amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one is a chemically versatile compound that has found potential applications in organic synthesis, pharmaceutical development, and material science. Its functional groups enable it to participate in a wide range of chemical reactions, making it a valuable intermediate for the synthesis of more complex molecules with desirable properties. References 2006. 4-Amino-6-tert-butyl-3-thioxo-3,4-dihydro-1,2,4-triazin-5(2H)-one. Acta Crystallographica Section E Structure Reports Online, 62(4). DOI: 10.1107/s1600536806008452 2017. Colonization of Paracoccus sp. QCT6 and Enhancement of Metribuzin Degradation in Maize Rhizosphere Soil. Current Microbiology, 75(2). DOI: 10.1007/s00284-017-1360-5 |
| Market Analysis Reports |