| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Oakwood Products, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 467-3386 | |||
![]() |
k_weaver@oakwoodchemical.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Cyclic hydrocarbon |
|---|---|
| Name | 1,2-Dichlorooctafluorocyclohex-1-Ene |
| Synonyms | 1,2-Dichloro-3,3,4,4,5,5,6,6-Octafluoro-Cyclohexene; Brn 1886511; Cyclohexene, 1,2-Dichloro-3,3,4,4,5,5,6,6-Octafluoro- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C6Cl2F8 |
| Molecular Weight | 294.96 |
| CAS Registry Number | 336-19-6 |
| EINECS | 206-408-7 |
| SMILES | C1(=C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)Cl)Cl |
| InChI | 1S/C6Cl2F8/c7-1-2(8)4(11,12)6(15,16)5(13,14)3(1,9)10 |
| InChIKey | BICOGOBTBGYGFA-UHFFFAOYSA-N |
| Density | 1.719 (Expl.) |
|---|---|
| 1.7±0.1g/cm3 (Cal.) | |
| Melting point | -70°C (Expl.) |
| Boiling point | 113°C (Expl.) |
| 111.5±40.0°C at 760 mmHg (Cal.) | |
| Flash point | 33.6±20.8°C (Cal.) |
| Refractive index | 1.375 (Expl.) |
| Safety Code | S36;S45 Details |
|---|---|
| Risk Code | R23 Details |
| Hazard Symbol | T Details |
| Transport Information | UN2810 |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
| DANGER: POISON, irritates skin, eyes, lungs | |
| SDS | Available |
| Market Analysis Reports |