| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | (E)-1-(2-Methoxyphenyl)-N-Phenylmethanimine |
|---|---|
| Synonyms | (E)-N-(2-Methoxybenzylidene)aniline; N-(o-Methoxybenzylidene)aniline; N-[(E)-(2-Methoxyphenyl)methylidene]aniline # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 |
| CAS Registry Number | 3369-37-7 |
| SMILES | O(c2ccccc2/C=N/c1ccccc1)C |
| InChI | 1S/C14H13NO/c1-16-14-10-6-5-7-12(14)11-15-13-8-3-2-4-9-13/h2-11H,1H3/b15-11+ |
| InChIKey | HBBUHFXBDZPAMN-RVDMUPIBSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.671°C at 760 mmHg (Cal.) |
| Flash point | 133.622°C (Cal.) |
| (1) | Michel Sliwa, Nicolas Mouton, Cyril Ruckebusch, Lionel Poisson, Abdenacer Idrissi, Stéphane Aloïse, Ludovic Potier, Julien Dubois, Olivier Poizat and Guy Buntinx. Investigation of ultrafast photoinduced processes for salicylidene aniline in solution and gas phase: toward a general photo-dynamical scheme, Photochem. Photobiol. Sci., 2010, 9, 661. |
|---|---|
| Market Analysis Reports |