| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Amino compound >> Cycloalkylamines, aromatic monoamines, aromatic polyamines and derivatives and salts |
|---|---|
| Name | (-)-2-[Methylamino]-1-Phenylpropane |
| Synonyms | (2R)-N-Methyl-1-Phenyl-Propan-2-Amine; Methyl-[(1R)-1-Methyl-2-Phenyl-Ethyl]Amine; (R)-Methylamphetamine |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 |
| CAS Registry Number | 33817-09-3 |
| EINECS | 251-687-0 |
| SMILES | [C@@H](CC1=CC=CC=C1)(NC)C |
| InChI | 1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | MYWUZJCMWCOHBA-SECBINFHSA-N |
| Density | 0.907g/cm3 (Cal.) |
|---|---|
| Boiling point | 215.533°C at 760 mmHg (Cal.) |
| Flash point | 86.781°C (Cal.) |
| Market Analysis Reports |