| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | (E)-N-(4-Fluorophenyl)-1-(3-Nitrophenyl)Methanimine |
|---|---|
| Synonyms | (1E)-1-(4-fluorophenyl)-2-(3-nitrophenyl)-1-azaethene; (4-fluorophenyl)(3-nitrobenzylidene)amine; 4-fluoro-N-(3-nitrobenzylidene)aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9FN2O2 |
| Molecular Weight | 244.22 |
| CAS Registry Number | 3382-80-7 |
| SMILES | Fc2ccc(/N=C/c1cccc([N+]([O-])=O)c1)cc2 |
| InChI | 1S/C13H9FN2O2/c14-11-4-6-12(7-5-11)15-9-10-2-1-3-13(8-10)16(17)18/h1-9H/b15-9+ |
| InChIKey | VEQIRTJULHMQCM-OQLLNIDSSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.006°C at 760 mmHg (Cal.) |
| Flash point | 187.855°C (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| SDS | Available |
| (1) | Minkin V I, Bren V A. Basicity and structure of azomethines and their structural analogs, Organic Reactivity, 1967, 4, 45-51 |
|---|---|
| Market Analysis Reports |