| Hefei TNJ Chemical Industry Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (551) 6541-8684 | |||
![]() |
sales@tnjchem.com | |||
| Chemical manufacturer since 2001 | ||||
| chemBlink massive supplier since 2021 | ||||
| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | Phenyl(1-Pyrrolidinyl)Methanone |
|---|---|
| Synonyms | (phenyl)pyrrolidin-1-ylmethanone; 1-benzoylpyrrolidine; InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 |
| CAS Registry Number | 3389-54-6 |
| SMILES | C1CCN(C1)C(=O)C2=CC=CC=C2 |
| InChI | 1S/C11H13NO/c13-11(12-8-4-5-9-12)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | VIQDUCBDZPYNNX-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.8±11.0°C at 760 mmHg (Cal.) |
| Flash point | 138.0±10.5°C (Cal.) |
| (1) | Hege Karlsen, Per Kolsaker, Christian Rømming and Einar Uggerud. The analogy between C?O and C(CN). Part 2. Structural properties of N,N-dialkylaminobenzamides and the analogously substituted 2-(phenylmethylene)propanedinitriles, J. Chem. Soc., Perkin Trans. 2, 2002, 0, 404. |
|---|---|
| Market Analysis Reports |