| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alsachim SAS | France | |||
|---|---|---|---|---|
![]() |
+33 (368) 240-080 | |||
![]() |
contact@alsachim.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | API >> Hormone and endocrine-regulating drugs >> Pancreatic hormones and other blood sugar regulating drugs |
|---|---|
| Name | Carbutamide |
| Synonyms | 3-(4-Aminophenyl)Sulfonyl-1-Butyl-Urea; Aronis018179; Zinc01764156 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17N3O3S |
| CAS Registry Number | 339-43-5 |
| EINECS | 206-424-4 |
| SMILES | C1=CC(=CC=C1[S](NC(NCCCC)=O)(=O)=O)N |
| InChI | 1S/C11H17N3O3S/c1-2-3-8-13-11(15)14-18(16,17)10-6-4-9(12)5-7-10/h4-7H,2-3,8,12H2,1H3,(H2,13,14,15) |
| InChIKey | VDTNNGKXZGSZIP-UHFFFAOYSA-N |
| SDS | Available |
|---|---|
| Market Analysis Reports |