| Pribolab Pte. Ltd. | Singapore | |||
|---|---|---|---|---|
![]() | www.pribolab.com | |||
![]() | +86 4006885349 | |||
![]() | sales@pribolab.com | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Classification | Analytical chemistry >> Standard >> Food and cosmetics standards |
|---|---|
| Name | T-2 triol |
| Synonyms | [(1S,2R,4S,7R,9R,10R,11S,12S)-10,11-dihydroxy-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4-yl] 3-methylbutanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 |
| CAS Registry Number | 34114-98-2 |
| EC Number | 621-636-0 |
| SMILES | CC1=C[C@@H]2[C@](C[C@@H]1OC(=O)CC(C)C)([C@]3([C@@H]([C@H]([C@H]([C@@]34CO4)O2)O)O)C)CO |
| Solubility | 1070 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.582, Calc.* |
| Melting point | 205.43 °C |
| Boiling Point | 484.66 °C, 527.1±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 182.1±23.6 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H300-H310-H315-H319-H330-H335 Details | ||||||||||||||||||||||||||||
| Safety Statements | P260-P261-P262-P264-P264+P265-P270-P271-P280-P284-P301+P316-P302+P352-P304+P340-P305+P351+P338-P316-P319-P320-P321-P330-P332+P317-P337+P317-P361+P364-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||
| Market Analysis Reports |