| Pribolab Pte. Ltd. | Singapore | |||
|---|---|---|---|---|
![]() | www.pribolab.com | |||
![]() | +86 4006885349 | |||
![]() | sales@pribolab.com | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Classification | Analytical chemistry >> Standard >> Food and cosmetics standards |
|---|---|
| Name | T-2 toxin tetraol |
| Synonyms | (1S,2R,4S,7R,9R,10R,11S,12S)-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4,10,11-triol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 |
| CAS Registry Number | 34114-99-3 |
| EC Number | 621-631-3 |
| SMILES | CC1=C[C@@H]2[C@](C[C@@H]1O)([C@]3([C@@H]([C@H]([C@H]([C@@]34CO4)O2)O)O)C)CO |
| Solubility | 3.871e+005 mg/L (25 °C water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.644, Calc.* |
| Melting point | 187.92 °C |
| Boiling Point | 447.16 °C, 515.2±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 265.4±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H300-H310-H315-H319-H330-H335 Details | ||||||||||||||||||||||||||||||||||||
| Safety Statements | P260-P261-P262-P264-P264+P265-P270-P271-P280-P284-P301+P316-P302+P352-P304+P340-P305+P351+P338-P316-P319-P320-P321-P330-P337+P317-P361+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||||||
| Market Analysis Reports |