| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 3-Cyclohexylamine nitrobenzoate |
|---|---|
| Synonyms | Cyclohexylamine; 3-Nitrobenzoic Acid; 3-Nitrobenzoic Acid Compd. With Cyclohexanamine (1:1); Benzoic Acid, 3-Nitro-, Compd. With Cyclohexanamine (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 34139-62-3 |
| SMILES | C1=C([N+]([O-])=O)C=CC=C1C(=O)O.C2C(N)CCCC2 |
| InChI | 1S/C7H5NO4.C6H13N/c9-7(10)5-2-1-3-6(4-5)8(11)12;7-6-4-2-1-3-5-6/h1-4H,(H,9,10);6H,1-5,7H2 |
| InChIKey | QMIMSBLFGDSHCY-UHFFFAOYSA-N |
| Boiling point | 340.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 157.5°C (Cal.) |
| Market Analysis Reports |