|
CAS#: 34209-97-7 Product: 2,4-Dichloro-1-[(E)-2-Nitroethenyl]Benzene No suppilers available for the product. |
| Name | 2,4-Dichloro-1-[(E)-2-Nitroethenyl]Benzene |
|---|---|
| Synonyms | 2,4-Dichloro-1-(2-Nitroethenyl)Benzene; 2,4-Dichloro-1-[(E)-2-Nitrovinyl]Benzene; 2,4-Dichloro-1-(2-Nitrovinyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.04 |
| CAS Registry Number | 34209-97-7 |
| SMILES | C1=C(Cl)C(=CC=C1Cl)\C=C\[N+]([O-])=O |
| InChI | 1S/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ |
| InChIKey | LIWIJBBAMBDXME-ONEGZZNKSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.114°C at 760 mmHg (Cal.) |
| Flash point | 155.867°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |