| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Name | H-Gly-D-Phe-OH |
|---|---|
| Synonyms | 2-[(2-Aminoacetyl)Amino]-3-Phenyl-Propanoic Acid; 2-[(2-Amino-1-Oxoethyl)Amino]-3-Phenylpropanoic Acid; 2-(Glycylamino)-3-Phenyl-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 34258-14-5 |
| SMILES | C1=C(CC(NC(CN)=O)C(O)=O)C=CC=C1 |
| InChI | 1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16) |
| InChIKey | JBCLFWXMTIKCCB-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.2±45.0°C at 760 mmHg (Cal.) |
| Flash point | 251.5±28.7°C (Cal.) |
| (1) | Magdalena Gellner, Stephan Niebling, Hannes Y. Kuchelmeister, Carsten Schmuck and Sebastian Schlücker. Plasmonically active micron-sized beads for integrated solid-phase synthesis and label-free SERS analysis, Chem. Commun., 2011, 47, 12762. |
|---|---|
| Market Analysis Reports |