| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 4-(2-Aminoethyl)Benzenesulfonyl Fluoride |
|---|---|
| Synonyms | Aids-122624; Aids122624; [4-(2-Aminoethyl)-Benzenesulphonyl Fluoride] |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10FNO2S |
| Molecular Weight | 203.23 |
| CAS Registry Number | 34284-75-8 |
| SMILES | C1=CC(=CC=C1[S](=O)(=O)F)CCN |
| InChI | 1S/C8H10FNO2S/c9-13(11,12)8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2 |
| InChIKey | MGSKVZWGBWPBTF-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.469°C at 760 mmHg (Cal.) |
| Flash point | 130.681°C (Cal.) |
| (1) | Hiroyuki Furusawa, Hiroki Takano and Yoshio Okahata. Transient kinetic studies of protein hydrolyses by endo- and exo-proteases on a 27 MHz quartz-crystal microbalance, Org. Biomol. Chem., 2008, 6, 727. |
|---|---|
| Market Analysis Reports |