| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Anvia Chemicals, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (414) 534-7845 | |||
![]() |
sales@anviachem.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | 4-Dimethylaminobenzylamine Dihydrochloride |
| Synonyms | (4-Dimethylaminophenyl)Methylammonium; (4-Dimethylaminobenzyl)Ammonium; Zinc00154092 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15N2 |
| Molecular Weight | 151.23 |
| CAS Registry Number | 34403-52-6 |
| SMILES | C1=CC(=CC=C1N(C)C)C[NH3+] |
| InChI | 1S/C9H14N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,7,10H2,1-2H3/p+1 |
| InChIKey | PDJZOFLRRJQYBF-UHFFFAOYSA-O |
| Boiling point | 260.05°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 98.583°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |